Structure of PDB 7m0n Chain B Binding Site BS01 |
|
|
Ligand ID | RLT |
InChI | InChI=1S/C20H21FN6O5/c1-10-25-26-17(32-10)16(30)24-20(2,3)19-23-13(14(28)18(31)27(19)4)15(29)22-9-11-5-7-12(21)8-6-11/h5-8,28H,9H2,1-4H3,(H,22,29)(H,24,30) |
InChIKey | CZFFBEXEKNGXKS-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | CN1C(=O)C(=C(N=C1C(C)(C)NC(=O)c2oc(C)nn2)C(=O)NCc3ccc(F)cc3)O | OpenEye OEToolkits 1.7.0 | Cc1nnc(o1)C(=O)NC(C)(C)C2=NC(=C(C(=O)N2C)O)C(=O)NCc3ccc(cc3)F |
|
Formula | C20 H21 F N6 O5 |
Name | N-(4-fluorobenzyl)-5-hydroxy-1-methyl-2-(1-methyl-1-{[(5-methyl-1,3,4-oxadiazol-2-yl)carbonyl]amino}ethyl)-6-oxo-1,6-di hydropyrimidine-4-carboxamide; RALTEGRAVIR, MK0518 |
ChEMBL | CHEMBL254316 |
DrugBank | DB06817 |
ZINC | ZINC000013831130
|
PDB chain | 7m0n Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|