Structure of PDB 7kxc Chain B Binding Site BS01 |
|
|
Ligand ID | 0JO |
InChI | InChI=1S/C11H13N2O7P/c1-6-10(14)9(4-13-7(2)11(15)16)8(3-12-6)5-20-21(17,18)19/h3-4,14H,2,5H2,1H3,(H,15,16)(H2,17,18,19)/b13-4+ |
InChIKey | BHIGINKEEFZJGX-YIXHJXPBSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=P(O)(O)OCc1cnc(c(O)c1/C=N/C(=C)C(=O)O)C | CACTVS 3.370 | Cc1ncc(CO[P](O)(O)=O)c(C=NC(=C)C(O)=O)c1O | OpenEye OEToolkits 1.7.6 | Cc1c(c(c(cn1)COP(=O)(O)O)C=NC(=C)C(=O)O)O | OpenEye OEToolkits 1.7.6 | Cc1c(c(c(cn1)COP(=O)(O)O)/C=N/C(=C)C(=O)O)O |
|
Formula | C11 H13 N2 O7 P |
Name | 2-{[(E)-{3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methylidene]amino}prop-2-enoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098207815
|
PDB chain | 7kxc Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
Global view | Local view | Structure summary |
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
PDB | 7kxc The aminoacrylate form of the wild-type Salmonella typhimurium Tryptophan Synthase in complex with inhibitor N-(4'-trifluoromethoxybenzenesulfonyl)-2-amino-1-ethylphosphate (F9F) at the enzyme alpha-site, sodium ion at the metal coordination site and benzimidazole (BZI) at the enzyme beta-site at 1.30 Angstrom resolution. One of the beta-Q114 rotamer conformations allows a hydrogen bond to form with the PLP oxygen at the position 3 in the ring. |
Resolution | 1.51 Å |
Binding residue (original residue number in PDB) | H86 K87 T110 G111 A112 Q114 H115 T190 G232 G234 S235 N236 G303 E350 S377 G378 |
Binding residue (residue number reindexed from 1) | H85 K86 T109 G110 A111 Q113 H114 T189 G231 G233 S234 N235 G302 E349 S376 G377 |
Annotation score | 1 |
|
|
Enzyme Commision number |
4.2.1.20: tryptophan synthase. |
|
|
|