Structure of PDB 7h2h Chain B Binding Site BS01 |
|
|
Ligand ID | A1AJ4 |
InChI | InChI=1S/C9H13N3/c10-6-5-9-11-7-3-1-2-4-8(7)12-9/h7-8H,1-5H2,(H,11,12)/t7-,8-/m0/s1 |
InChIKey | MTYFPGDPOCYMJB-YUMQZZPRSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | N#CCC1=N[CH]2CCCC[CH]2N1 | OpenEye OEToolkits 2.0.7 | C1CC[C@H]2[C@@H](C1)NC(=N2)CC#N | CACTVS 3.385 | N#CCC1=N[C@H]2CCCC[C@H]2N1 | ACDLabs 12.01 | N#CCC1=NC2CCCCC2N1 | OpenEye OEToolkits 2.0.7 | C1CCC2C(C1)NC(=N2)CC#N |
|
Formula | C9 H13 N3 |
Name | [(3aR,7aS)-3a,4,5,6,7,7a-hexahydro-1H-1,3-benzimidazol-2-yl]acetonitrile |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7h2h Chain B Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|