Structure of PDB 7h2b Chain B Binding Site BS01 |
|
|
Ligand ID | A1AJ3 |
InChI | InChI=1S/C10H17N3OS/c1-7-11-9(15-13-7)12-8-4-3-5-10(8,2)6-14/h8,14H,3-6H2,1-2H3,(H,11,12,13)/t8-,10+/m0/s1 |
InChIKey | OXBOFYWMHPKHNR-WCBMZHEXSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1nsc(N[CH]2CCC[C]2(C)CO)n1 | OpenEye OEToolkits 2.0.7 | Cc1nc(sn1)N[C@H]2CCC[C@]2(C)CO | OpenEye OEToolkits 2.0.7 | Cc1nc(sn1)NC2CCCC2(C)CO | CACTVS 3.385 | Cc1nsc(N[C@H]2CCC[C@]2(C)CO)n1 | ACDLabs 12.01 | Cc1nc(NC2CCCC2(C)CO)sn1 |
|
Formula | C10 H17 N3 O S |
Name | {(1S,2S)-1-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]cyclopentyl}methanol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7h2b Chain B Residue 205
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|