Structure of PDB 7gkv Chain B Binding Site BS01 |
|
|
Ligand ID | R0F |
InChI | InChI=1S/C22H21ClN4O2/c1-24-21(28)13-27-11-15-6-7-16(23)8-18(15)19(12-27)22(29)26-20-10-25-9-14-4-2-3-5-17(14)20/h2-10,19H,11-13H2,1H3,(H,24,28)(H,26,29)/t19-/m1/s1 |
InChIKey | BNHZFFZRNBJNJB-LJQANCHMSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CNC(=O)CN1C[C@@H](C(=O)Nc2cncc3ccccc23)c4cc(Cl)ccc4C1 | OpenEye OEToolkits 2.0.7 | CNC(=O)CN1Cc2ccc(cc2C(C1)C(=O)Nc3cncc4c3cccc4)Cl | CACTVS 3.385 | CNC(=O)CN1C[CH](C(=O)Nc2cncc3ccccc23)c4cc(Cl)ccc4C1 | OpenEye OEToolkits 2.0.7 | CNC(=O)CN1Cc2ccc(cc2[C@@H](C1)C(=O)Nc3cncc4c3cccc4)Cl | ACDLabs 12.01 | CNC(=O)CN1Cc2ccc(Cl)cc2C(C1)C(=O)Nc1cncc2ccccc21 |
|
Formula | C22 H21 Cl N4 O2 |
Name | (4S)-6-chloro-N-(isoquinolin-4-yl)-2-[2-(methylamino)-2-oxoethyl]-1,2,3,4-tetrahydroisoquinoline-4-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7gkv Chain B Residue 404
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|