Structure of PDB 7ghz Chain B Binding Site BS01 |
|
|
Ligand ID | PJX |
InChI | InChI=1S/C20H18ClN3O/c1-24-9-8-16(17-10-14(21)6-7-19(17)24)20(25)23-18-12-22-11-13-4-2-3-5-15(13)18/h2-7,10-12,16H,8-9H2,1H3,(H,23,25)/t16-/m1/s1 |
InChIKey | NIZLDWOVHDTVKM-MRXNPFEDSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Clc1ccc2c(c1)C(CCN2C)C(=O)Nc1cncc2ccccc21 | OpenEye OEToolkits 2.0.7 | CN1CCC(c2c1ccc(c2)Cl)C(=O)Nc3cncc4c3cccc4 | CACTVS 3.385 | CN1CC[C@@H](C(=O)Nc2cncc3ccccc23)c4cc(Cl)ccc14 | OpenEye OEToolkits 2.0.7 | CN1CC[C@H](c2c1ccc(c2)Cl)C(=O)Nc3cncc4c3cccc4 | CACTVS 3.385 | CN1CC[CH](C(=O)Nc2cncc3ccccc23)c4cc(Cl)ccc14 |
|
Formula | C20 H18 Cl N3 O |
Name | (4R)-6-chloro-N-(isoquinolin-4-yl)-1-methyl-1,2,3,4-tetrahydroquinoline-4-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7ghz Chain B Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|