Structure of PDB 7fr8 Chain B Binding Site BS01 |
|
|
Ligand ID | WXF |
InChI | InChI=1S/C12H14N4O3/c1-7-6-16(4-5-19-7)11(17)8-2-3-13-10-9(8)14-12(18)15-10/h2-3,7H,4-6H2,1H3,(H2,13,14,15,18)/t7-/m1/s1 |
InChIKey | HZXBKRVXTGQUNC-SSDOTTSWSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | CC1CN(CCO1)C(=O)c1ccnc2[NH]c(O)nc21 | OpenEye OEToolkits 2.0.7 | CC1CN(CCO1)C(=O)c2ccnc3c2nc([nH]3)O | OpenEye OEToolkits 2.0.7 | C[C@@H]1CN(CCO1)C(=O)c2ccnc3c2nc([nH]3)O | CACTVS 3.385 | C[CH]1CN(CCO1)C(=O)c2ccnc3[nH]c(O)nc23 | CACTVS 3.385 | C[C@@H]1CN(CCO1)C(=O)c2ccnc3[nH]c(O)nc23 |
|
Formula | C12 H14 N4 O3 |
Name | (2-hydroxy-3H-imidazo[4,5-b]pyridin-7-yl)[(2R)-2-methylmorpholin-4-yl]methanone |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7fr8 Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|