Structure of PDB 7fov Chain B Binding Site BS01 |
|
|
Ligand ID | WCT |
InChI | InChI=1S/C9H11F3N2O3/c1-5-4-6(17-14-5)8(16)13-3-2-7(15)9(10,11)12/h4,7,15H,2-3H2,1H3,(H,13,16)/t7-/m0/s1 |
InChIKey | UFYWGEDIOOTKBU-ZETCQYMHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | Cc1cc(on1)C(=O)NCCC(C(F)(F)F)O | OpenEye OEToolkits 2.0.7 | Cc1cc(on1)C(=O)NCC[C@@H](C(F)(F)F)O | ACDLabs 12.01 | O=C(NCCC(O)C(F)(F)F)c1cc(C)no1 | CACTVS 3.385 | Cc1cc(on1)C(=O)NCC[CH](O)C(F)(F)F | CACTVS 3.385 | Cc1cc(on1)C(=O)NCC[C@H](O)C(F)(F)F |
|
Formula | C9 H11 F3 N2 O3 |
Name | 3-methyl-N-[(3S)-4,4,4-trifluoro-3-hydroxybutyl]-1,2-oxazole-5-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000072288839
|
PDB chain | 7fov Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|