Structure of PDB 7f80 Chain B Binding Site BS01 |
|
|
Ligand ID | 1KF |
InChI | InChI=1S/C25H27F3N2O3/c1-17(14-23(31)32)6-5-13-33-22-8-4-3-7-20(22)16-30-18(2)15-29-24(30)19-9-11-21(12-10-19)25(26,27)28/h3-4,7-12,15,17H,5-6,13-14,16H2,1-2H3,(H,31,32)/t17-/m1/s1 |
InChIKey | FMOPHFSPINWSOV-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | Cc1cnc(n1Cc2ccccc2OCCC[C@@H](C)CC(=O)O)c3ccc(cc3)C(F)(F)F | CACTVS 3.385 | C[C@H](CCCOc1ccccc1Cn2c(C)cnc2c3ccc(cc3)C(F)(F)F)CC(O)=O | CACTVS 3.385 | C[CH](CCCOc1ccccc1Cn2c(C)cnc2c3ccc(cc3)C(F)(F)F)CC(O)=O | OpenEye OEToolkits 2.0.7 | Cc1cnc(n1Cc2ccccc2OCCCC(C)CC(=O)O)c3ccc(cc3)C(F)(F)F |
|
Formula | C25 H27 F3 N2 O3 |
Name | (3R)-3-methyl-6-[2-[[5-methyl-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methyl]phenoxy]hexanoic acid |
ChEMBL | CHEMBL5095171 |
DrugBank | DB16906 |
ZINC |
|
PDB chain | 7f80 Chain B Residue 900
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|