Structure of PDB 7cs7 Chain B Binding Site BS01 |
|
|
Ligand ID | GNU |
InChI | InChI=1S/C20H26O6/c1-25-19-9-13(3-5-17(19)23)7-15(11-21)16(12-22)8-14-4-6-18(24)20(10-14)26-2/h3-6,9-10,15-16,21-24H,7-8,11-12H2,1-2H3/t15-,16-/m1/s1 |
InChIKey | PUETUDUXMCLALY-HZPDHXFCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cc(C[CH](CO)[CH](CO)Cc2ccc(O)c(OC)c2)ccc1O | OpenEye OEToolkits 2.0.7 | COc1cc(ccc1O)CC(CO)C(Cc2ccc(c(c2)OC)O)CO | CACTVS 3.385 | COc1cc(C[C@H](CO)[C@@H](CO)Cc2ccc(O)c(OC)c2)ccc1O | OpenEye OEToolkits 2.0.7 | COc1cc(ccc1O)C[C@H](CO)[C@H](Cc2ccc(c(c2)OC)O)CO |
|
Formula | C20 H26 O6 |
Name | (2S,3S)-2,3-bis[(3-methoxy-4-oxidanyl-phenyl)methyl]butane-1,4-diol; (+)-secoisolariciresinol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000014694365
|
PDB chain | 7cs7 Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|