Structure of PDB 7cpq Chain B Binding Site BS01 |
|
|
Ligand ID | G9X |
InChI | InChI=1S/C20H18ClNO/c21-16-8-9-17-15(12-22-19(17)11-16)10-14-6-3-5-13-4-1-2-7-18(13)20(14)23/h1-2,4,7-9,11-12,14,22H,3,5-6,10H2/t14-/m1/s1 |
InChIKey | GVUXLVCNOFJITN-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)CCCC(C2=O)Cc3c[nH]c4c3ccc(c4)Cl | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)CCC[C@@H](C2=O)Cc3c[nH]c4c3ccc(c4)Cl | CACTVS 3.385 | Clc1ccc2c(C[CH]3CCCc4ccccc4C3=O)c[nH]c2c1 | CACTVS 3.385 | Clc1ccc2c(C[C@H]3CCCc4ccccc4C3=O)c[nH]c2c1 |
|
Formula | C20 H18 Cl N O |
Name | (6R)-6-[(6-chloranyl-1H-indol-3-yl)methyl]-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7cpq Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|