Structure of PDB 7cj7 Chain B Binding Site BS01 |
|
|
Ligand ID | FZU |
InChI | InChI=1S/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,7-11H,1-2H2/t3-,4+,5+,6+/m0/s1 |
InChIKey | LKDRXBCSQODPBY-SLPGGIOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC[C]1(O)OC[CH](O)[CH](O)[CH]1O | CACTVS 3.385 | OC[C@@]1(O)OC[C@H](O)[C@@H](O)[C@H]1O | OpenEye OEToolkits 2.0.7 | C1[C@@H]([C@H]([C@H]([C@](O1)(CO)O)O)O)O | OpenEye OEToolkits 2.0.7 | C1C(C(C(C(O1)(CO)O)O)O)O |
|
Formula | C6 H12 O6 |
Name | (2R,3R,4R,5S)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000000895384
|
PDB chain | 7cj7 Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
5.1.3.31: D-tagatose 3-epimerase. |
|
|
|