Structure of PDB 6xq1 Chain B Binding Site BS01 |
|
|
Ligand ID | V74 |
InChI | InChI=1S/C30H23NO6/c32-29(33)21-11-13-23(14-12-21)37-24-8-4-6-20(16-24)18-36-17-19-5-3-7-22(15-19)27-25-9-1-2-10-26(25)31-28(27)30(34)35/h1-16,31H,17-18H2,(H,32,33)(H,34,35) |
InChIKey | LURNKRQADJFMRR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)c1[nH]c2ccccc2c1c3cccc(COCc4cccc(Oc5ccc(cc5)C(O)=O)c4)c3 | ACDLabs 12.01 | c1cc(cc(c1)Oc2ccc(C(O)=O)cc2)COCc5cc(c4c3c(cccc3)nc4C(O)=O)ccc5 | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)c(c([nH]2)C(=O)O)c3cccc(c3)COCc4cccc(c4)Oc5ccc(cc5)C(=O)O |
|
Formula | C30 H23 N O6 |
Name | 3-[3-({[3-(4-carboxyphenoxy)phenyl]methoxy}methyl)phenyl]-1H-indole-2-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6xq1 Chain B Residue 305
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|