Structure of PDB 6xl8 Chain B Binding Site BS01 |
|
|
Ligand ID | GNS |
InChI | InChI=1S/C6H13NO8S/c8-1-2-4(9)5(10)3(6(11)15-2)7-16(12,13)14/h2-11H,1H2,(H,12,13,14)/t2-,3-,4-,5-,6+/m1/s1 |
InChIKey | PRDZVHCOEWJPOB-UKFBFLRUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)NS(=O)(=O)O)O)O)O | ACDLabs 12.01 | O=S(=O)(O)NC1C(O)C(O)C(OC1O)CO | CACTVS 3.370 | OC[C@H]1O[C@H](O)[C@H](N[S](O)(=O)=O)[C@@H](O)[C@@H]1O | OpenEye OEToolkits 1.7.2 | C(C1C(C(C(C(O1)O)NS(=O)(=O)O)O)O)O | CACTVS 3.370 | OC[CH]1O[CH](O)[CH](N[S](O)(=O)=O)[CH](O)[CH]1O |
|
Formula | C6 H13 N O8 S |
Name | 2-deoxy-2-(sulfoamino)-alpha-D-glucopyranose; N-SULFO-ALPHA-D-GLUCOSAMINE; 2-deoxy-2-(sulfoamino)-alpha-D-glucose; 2-deoxy-2-(sulfoamino)-D-glucose; 2-deoxy-2-(sulfoamino)-glucose |
ChEMBL | |
DrugBank | |
ZINC | ZINC000005830072
|
PDB chain | 6xl8 Chain D Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.8.2.30: [heparan sulfate]-glucosamine 3-sulfotransferase 3. |
|
|
|