Structure of PDB 6xe3 Chain B Binding Site BS01 |
|
|
Ligand ID | 1D0 |
InChI | InChI=1S/C17H20N3O8P/c1-10-16(22)12(11(6-18-10)9-28-29(25,26)27)7-19-14(17(23)24)8-20-13-4-2-3-5-15(13)21/h2-6,20-22H,7-9H2,1H3,(H,23,24)(H2,25,26,27)/b19-14+ |
InChIKey | MKNJFLJOSVXALN-XMHGGMMESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Cc1ncc(CO[P](O)(O)=O)c(CN=C(CNc2ccccc2O)C(O)=O)c1O | ACDLabs 12.01 | O=C(O)/C(=N/Cc1c(cnc(c1O)C)COP(=O)(O)O)CNc2ccccc2O | OpenEye OEToolkits 1.7.6 | Cc1c(c(c(cn1)COP(=O)(O)O)CN=C(CNc2ccccc2O)C(=O)O)O | OpenEye OEToolkits 1.7.6 | Cc1c(c(c(cn1)COP(=O)(O)O)C/N=C(\CNc2ccccc2O)/C(=O)O)O |
|
Formula | C17 H20 N3 O8 P |
Name | (2E)-2-[({3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methyl)imino]-3-[(2-hydroxyphenyl)amino]propanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098207946
|
PDB chain | 6xe3 Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
4.2.1.20: tryptophan synthase. |
|
|
|