Structure of PDB 6wv7 Chain B Binding Site BS01 |
|
|
Ligand ID | UAJ |
InChI | InChI=1S/C23H15ClO3/c24-16-12-10-15(11-13-16)19(14-6-2-1-3-7-14)23(27)20-21(25)17-8-4-5-9-18(17)22(20)26/h1-13,19-20H/t19-/m1/s1 |
InChIKey | UDHXJZHVNHGCEC-LJQANCHMSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccc(cc1)C(c2ccc(cc2)Cl)C(=O)C3C(=O)c4ccccc4C3=O | CACTVS 3.385 | Clc1ccc(cc1)[C@H](C(=O)C2C(=O)c3ccccc3C2=O)c4ccccc4 | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)[C@H](c2ccc(cc2)Cl)C(=O)C3C(=O)c4ccccc4C3=O | ACDLabs 12.01 | c1ccc(cc1)C(C(C3C(=O)c2ccccc2C3=O)=O)c4ccc(Cl)cc4 | CACTVS 3.385 | Clc1ccc(cc1)[CH](C(=O)C2C(=O)c3ccccc3C2=O)c4ccccc4 |
|
Formula | C23 H15 Cl O3 |
Name | Chlorophacinone; 2-[(2R)-2-(4-chlorophenyl)-2-phenylacetyl]-1H-indene-1,3(2H)-dione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000100038034
|
PDB chain | 6wv7 Chain B Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.17.4.4: vitamin-K-epoxide reductase (warfarin-sensitive). |
|
|
|