Structure of PDB 6w8q Chain B Binding Site BS01 |
|
|
Ligand ID | TJS |
InChI | InChI=1S/C9H10N2O3/c12-8(13)7-5-3-1-2-4-6(5)10-9(14)11-7/h1-4H2,(H,12,13)(H,10,11,14) |
InChIKey | STARWXDKVTUOKH-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)C1=NC(=O)NC2=C1CCCC2 | OpenEye OEToolkits 2.0.7 | C1CCC2=C(C1)C(=NC(=O)N2)C(=O)O | ACDLabs 12.01 | C1CCCC2=C1NC(N=C2C(O)=O)=O |
|
Formula | C9 H10 N2 O3 |
Name | 2-oxo-1,2,5,6,7,8-hexahydroquinazoline-4-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000012243743
|
PDB chain | 6w8q Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|