Structure of PDB 6vuf Chain B Binding Site BS01 |
|
|
Ligand ID | RLV |
InChI | InChI=1S/C14H20N2O3S/c1-3-8-15-20(18,19)13-6-4-11(5-7-13)12-9-14(17)16(2)10-12/h4-7,12,15H,3,8-10H2,1-2H3/t12-/m0/s1 |
InChIKey | UOJMSGYUFCDFLH-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CCCNS(=O)(=O)c1ccc(cc1)[C@H]2CC(=O)N(C2)C | CACTVS 3.385 | CCCN[S](=O)(=O)c1ccc(cc1)[C@@H]2CN(C)C(=O)C2 | ACDLabs 12.01 | CN2C(CC(c1ccc(S(NCCC)(=O)=O)cc1)C2)=O | OpenEye OEToolkits 2.0.7 | CCCNS(=O)(=O)c1ccc(cc1)C2CC(=O)N(C2)C | CACTVS 3.385 | CCCN[S](=O)(=O)c1ccc(cc1)[CH]2CN(C)C(=O)C2 |
|
Formula | C14 H20 N2 O3 S |
Name | 4-[(3R)-1-methyl-5-oxopyrrolidin-3-yl]-N-propylbenzene-1-sulfonamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6vuf Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|