Structure of PDB 6vsf Chain B Binding Site BS01 |
|
|
Ligand ID | RKY |
InChI | InChI=1S/C13H14O5/c14-10(3-5-13(15)16)9-2-4-11-12(8-9)18-7-1-6-17-11/h2,4,8H,1,3,5-7H2,(H,15,16) |
InChIKey | RQYNFIARXFWNDM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)CCC(=O)c1ccc2OCCCOc2c1 | OpenEye OEToolkits 2.0.7 | c1cc2c(cc1C(=O)CCC(=O)O)OCCCO2 | ACDLabs 12.01 | c1cc(C(CCC(O)=O)=O)cc2c1OCCCO2 |
|
Formula | C13 H14 O5 |
Name | 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-oxobutanoic acid |
ChEMBL | CHEMBL1349957 |
DrugBank | |
ZINC | ZINC000003888072
|
PDB chain | 6vsf Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|