Structure of PDB 6vne Chain B Binding Site BS01 |
|
|
Ligand ID | 2TA |
InChI | InChI=1S/C27H36N6O3S/c1-20-19-28-26(30-21-10-12-23(13-11-21)36-17-16-33-14-5-6-15-33)31-25(20)29-22-8-7-9-24(18-22)37(34,35)32-27(2,3)4/h7-13,18-19,32H,5-6,14-17H2,1-4H3,(H2,28,29,30,31) |
InChIKey | JOOXLOJCABQBSG-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=S(=O)(NC(C)(C)C)c1cccc(c1)Nc2nc(ncc2C)Nc4ccc(OCCN3CCCC3)cc4 | OpenEye OEToolkits 1.7.6 | Cc1cnc(nc1Nc2cccc(c2)S(=O)(=O)NC(C)(C)C)Nc3ccc(cc3)OCCN4CCCC4 | CACTVS 3.385 | Cc1cnc(Nc2ccc(OCCN3CCCC3)cc2)nc1Nc4cccc(c4)[S](=O)(=O)NC(C)(C)C |
|
Formula | C27 H36 N6 O3 S |
Name | N-tert-butyl-3-{[5-methyl-2-({4-[2-(pyrrolidin-1-yl)ethoxy]phenyl}amino)pyrimidin-4-yl]amino}benzenesulfonamide; Fedratinib |
ChEMBL | CHEMBL1287853 |
DrugBank | DB12500 |
ZINC | ZINC000019862646
|
PDB chain | 6vne Chain B Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|