Structure of PDB 6vh2 Chain B Binding Site BS01 |
|
|
|
| Ligand ID | QZ4 |
| InChI | InChI=1S/C23H37F2N3O5/c24-23(25)9-6-18(7-10-23)33-22(32)28-19(12-15-4-2-1-3-5-15)21(31)27-17(14-29)13-16-8-11-26-20(16)30/h15-19,29H,1-14H2,(H,26,30)(H,27,31)(H,28,32)/t16-,17-,19-/m0/s1 |
| InChIKey | WERUFESDSMNWQU-LNLFQRSKSA-N |
| SMILES | | Software | SMILES |
|---|
| OpenEye OEToolkits 2.0.7 | C1CCC(CC1)C[C@@H](C(=O)N[C@@H](C[C@@H]2CCNC2=O)CO)NC(=O)OC3CCC(CC3)(F)F | | OpenEye OEToolkits 2.0.7 | C1CCC(CC1)CC(C(=O)NC(CC2CCNC2=O)CO)NC(=O)OC3CCC(CC3)(F)F | | CACTVS 3.385 | OC[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC2CCCCC2)NC(=O)OC3CCC(F)(F)CC3 | | ACDLabs 12.01 | C(CC1CCCCC1)(C(NC(CC2C(=O)NCC2)CO)=O)NC(=O)OC3CCC(CC3)(F)F | | CACTVS 3.385 | OC[CH](C[CH]1CCNC1=O)NC(=O)[CH](CC2CCCCC2)NC(=O)OC3CCC(F)(F)CC3 |
|
| Formula | C23 H37 F2 N3 O5 |
| Name | 4,4-difluorocyclohexyl [(2S)-3-cyclohexyl-1-({(2S)-1-hydroxy-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl}amino)-1-oxopropan-2-yl]carbamate |
| ChEMBL | |
| DrugBank | |
| ZINC |
|
| PDB chain | 6vh2 Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|
|
|
|
|
