Structure of PDB 6s8k Chain B Binding Site BS01 |
|
|
Ligand ID | PN6 |
InChI | InChI=1S/C19H20N4O2/c1-19(2,3)16-13(20-11-21-16)10-15-18(25)22-14(17(24)23-15)9-12-7-5-4-6-8-12/h4-11H,1-3H3,(H,20,21)(H,22,25)(H,23,24)/b14-9-,15-10- |
InChIKey | UNRCMCRRFYFGFX-TYPNBTCFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)(C)c1[nH]cnc1C=C2NC(=O)C(NC2=O)=Cc3ccccc3 | ACDLabs 12.01 | [C@H](c1ncnc1C(C)(C)C)=C2NC(=O)C(NC2=O)=[C@H]c3ccccc3 | OpenEye OEToolkits 1.9.2 | CC(C)(C)c1c(nc[nH]1)/C=C\2/C(=O)N/C(=C\c3ccccc3)/C(=O)N2 | OpenEye OEToolkits 1.9.2 | CC(C)(C)c1c(nc[nH]1)C=C2C(=O)NC(=Cc3ccccc3)C(=O)N2 | CACTVS 3.385 | CC(C)(C)c1[nH]cnc1/C=C/2NC(=O)C(/NC/2=O)=C/c3ccccc3 |
|
Formula | C19 H20 N4 O2 |
Name | (3Z,6Z)-3-benzylidene-6-[(5-tert-butyl-1H-imidazol-4-yl)methylidene]piperazine-2,5-dione; Plinabulin |
ChEMBL | CHEMBL1096380 |
DrugBank | DB05992 |
ZINC | ZINC000003819466
|
PDB chain | 6s8k Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|