Structure of PDB 6s41 Chain B Binding Site BS01 |
|
|
Ligand ID | KUB |
InChI | InChI=1S/C17H13ClF3N3O2S2/c1-9(11-4-10(19)2-3-13(11)20)23-15-6-14(21)16(5-12(15)18)28(25,26)24-17-7-27-8-22-17/h2-9,23-24H,1H3/t9-/m0/s1 |
InChIKey | KLWKJFRXLGLTIH-VIFPVBQESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(c1cc(ccc1F)F)Nc2cc(c(cc2Cl)S(=O)(=O)Nc3cscn3)F | OpenEye OEToolkits 2.0.7 | C[C@@H](c1cc(ccc1F)F)Nc2cc(c(cc2Cl)S(=O)(=O)Nc3cscn3)F | CACTVS 3.385 | C[CH](Nc1cc(F)c(cc1Cl)[S](=O)(=O)Nc2cscn2)c3cc(F)ccc3F | CACTVS 3.385 | C[C@H](Nc1cc(F)c(cc1Cl)[S](=O)(=O)Nc2cscn2)c3cc(F)ccc3F |
|
Formula | C17 H13 Cl F3 N3 O2 S2 |
Name | 4-[[(1~{S})-1-[2,5-bis(fluoranyl)phenyl]ethyl]amino]-5-chloranyl-2-fluoranyl-~{N}-(1,3-thiazol-4-yl)benzenesulfonamide |
ChEMBL | CHEMBL4580996 |
DrugBank | |
ZINC |
|
PDB chain | 6s41 Chain B Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|