Structure of PDB 6odl Chain B Binding Site BS01 |
|
|
Ligand ID | M7V |
InChI | InChI=1S/C10H17NO4/c1-2-3-4-10(9(14)15)5-6(10)7(11)8(12)13/h6-7H,2-5,11H2,1H3,(H,12,13)(H,14,15)/t6-,7-,10-/m0/s1 |
InChIKey | CJQORTJFEFUXDX-BYULHYEWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCCC[C]1(C[CH]1[CH](N)C(O)=O)C(O)=O | OpenEye OEToolkits 2.0.7 | CCCCC1(CC1C(C(=O)O)N)C(=O)O | OpenEye OEToolkits 2.0.7 | CCCC[C@@]1(C[C@H]1[C@@H](C(=O)O)N)C(=O)O | CACTVS 3.385 | CCCC[C@@]1(C[C@H]1[C@H](N)C(O)=O)C(O)=O | ACDLabs 12.01 | CCCCC1(C(C(C(O)=O)N)C1)C(O)=O |
|
Formula | C10 H17 N O4 |
Name | (1S,2R)-2-[(S)-amino(carboxy)methyl]-1-butylcyclopropane-1-carboxylic acid |
ChEMBL | CHEMBL2365794 |
DrugBank | |
ZINC | ZINC000095598690
|
PDB chain | 6odl Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|