Structure of PDB 6ntt Chain B Binding Site BS01 |
|
|
Ligand ID | 21D |
InChI | InChI=1S/C10H8O6S2/c11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16/h1-6H,(H,11,12,13)(H,14,15,16) |
InChIKey | XTEGVFVZDVNBPF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O[S](=O)(=O)c1cccc2c1cccc2[S](O)(=O)=O | OpenEye OEToolkits 1.7.6 | c1cc2c(cccc2S(=O)(=O)O)c(c1)S(=O)(=O)O | ACDLabs 12.01 | O=S(=O)(O)c1cccc2c1cccc2S(=O)(=O)O |
|
Formula | C10 H8 O6 S2 |
Name | naphthalene-1,5-disulfonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000001605332
|
PDB chain | 6ntt Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|