Structure of PDB 6nej Chain B Binding Site BS01 |
|
|
Ligand ID | SLX |
InChI | InChI=1S/C19H21NO4/c1-23-17-4-3-11-7-15-13-9-16(21)18(24-2)8-12(13)5-6-20(15)10-14(11)19(17)22/h3-4,8-9,15,21-22H,5-7,10H2,1-2H3/t15-/m0/s1 |
InChIKey | KNWVMRVOBAFFMH-HNNXBMFYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | Oc1c4c(ccc1OC)CC3c2c(cc(OC)c(O)c2)CCN3C4 | CACTVS 3.341 | COc1ccc2C[C@@H]3N(CCc4cc(OC)c(O)cc34)Cc2c1O | OpenEye OEToolkits 1.5.0 | COc1ccc2c(c1O)CN3CCc4cc(c(cc4C3C2)O)OC | OpenEye OEToolkits 1.5.0 | COc1ccc2c(c1O)C[N@]3CCc4cc(c(cc4[C@@H]3C2)O)OC | CACTVS 3.341 | COc1ccc2C[CH]3N(CCc4cc(OC)c(O)cc34)Cc2c1O |
|
Formula | C19 H21 N O4 |
Name | (13aS)-3,10-dimethoxy-5,8,13,13a-tetrahydro-6H-isoquino[3,2-a]isoquinoline-2,9-diol; (S)-scoulerine |
ChEMBL | CHEMBL1235966 |
DrugBank | |
ZINC | ZINC000028465419
|
PDB chain | 6nej Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.1.1.117: (S)-scoulerine 9-O-methyltransferase. |
|
|
|