Structure of PDB 6l96 Chain B Binding Site BS01 |
|
|
Ligand ID | P7F |
InChI | InChI=1S/C28H30N2O6/c1-3-25(27(31)32)35-23-9-6-8-20(18-23)19-30(28-29-24-10-4-5-11-26(24)36-28)16-7-17-34-22-14-12-21(33-2)13-15-22/h4-6,8-15,18,25H,3,7,16-17,19H2,1-2H3,(H,31,32)/t25-/m1/s1 |
InChIKey | ZHKNLJLMDFQVHJ-RUZDIDTESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC[C@H](C(=O)O)Oc1cccc(c1)CN(CCCOc2ccc(cc2)OC)c3nc4ccccc4o3 | OpenEye OEToolkits 2.0.6 | CCC(C(=O)O)Oc1cccc(c1)CN(CCCOc2ccc(cc2)OC)c3nc4ccccc4o3 | CACTVS 3.385 | CC[CH](Oc1cccc(CN(CCCOc2ccc(OC)cc2)c3oc4ccccc4n3)c1)C(O)=O | CACTVS 3.385 | CC[C@@H](Oc1cccc(CN(CCCOc2ccc(OC)cc2)c3oc4ccccc4n3)c1)C(O)=O |
|
Formula | C28 H30 N2 O6 |
Name | (2~{R})-2-[3-[[1,3-benzoxazol-2-yl-[3-(4-methoxyphenoxy)propyl]amino]methyl]phenoxy]butanoic acid |
ChEMBL | CHEMBL247951 |
DrugBank | DB15212 |
ZINC |
|
PDB chain | 6l96 Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|