Structure of PDB 6i5g Chain B Binding Site BS01 |
|
|
Ligand ID | PTG |
InChI | InChI=1S/C20H28O3/c1-2-3-4-5-6-10-13-18-17(15-16-19(18)21)12-9-7-8-11-14-20(22)23/h6-7,9-10,13,15-17H,2-5,8,11-12,14H2,1H3,(H,22,23)/b9-7+,10-6+,18-13-/t17-/m0/s1 |
InChIKey | VHRUMKCAEVRUBK-XOVNXQNQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CCCCC\C=C\C=C1[C@H](C=CC1=O)C\C=C\CCCC(=O)O | CACTVS 3.341 | CCCCC\C=C\C=C/1[C@@H](C\C=C\CCCC(O)=O)C=CC/1=O | ACDLabs 10.04 | O=C\1C=CC(C/1=C\C=C\CCCCC)C/C=C/CCCC(=O)O | CACTVS 3.341 | CCCCCC=CC=C1[CH](CC=CCCCC(O)=O)C=CC1=O | OpenEye OEToolkits 1.5.0 | CCCCCC=CC=C1C(C=CC1=O)CC=CCCCC(=O)O |
|
Formula | C20 H28 O3 |
Name | (5E,14E)-11-oxoprosta-5,9,12,14-tetraen-1-oic acid; 15-deoxy-delta(12,14)-prostaglandin J2 |
ChEMBL | CHEMBL1210221 |
DrugBank | DB08435 |
ZINC | ZINC000038139032
|
PDB chain | 6i5g Chain B Residue 607
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|