Structure of PDB 6egu Chain B Binding Site BS01 |
|
|
Ligand ID | 43Y |
InChI | InChI=1S/C14H28NO8P/c1-6-13(16)20-10-12(23-14(17)7-2)11-22-24(18,19)21-9-8-15(3,4)5/h12H,6-11H2,1-5H3/p+1/t12-/m1/s1 |
InChIKey | LMBVWVMURYPSQM-GFCCVEGCSA-O |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CC | OpenEye OEToolkits 1.7.6 | CCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CC | CACTVS 3.385 | CCC(=O)OC[CH](CO[P](O)(=O)OCC[N+](C)(C)C)OC(=O)CC | CACTVS 3.385 | CCC(=O)OC[C@H](CO[P](O)(=O)OCC[N+](C)(C)C)OC(=O)CC | ACDLabs 12.01 | O=C(OCC(OC(=O)CC)COP(=O)(OCC[N+](C)(C)C)O)CC |
|
Formula | C14 H29 N O8 P |
Name | [(2R)-3-[oxidanyl-[2-(trimethyl-$l^{4}-azanyl)ethoxy]phosphoryl]oxy-2-propanoyloxy-propyl] propanoate; 1,2-dipropionyl-sn-glycero-3-phosphocholine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013508374
|
PDB chain | 6egu Chain B Residue 1305
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|