Structure of PDB 6e7s Chain B Binding Site BS01 |
|
|
Ligand ID | HZ4 |
InChI | InChI=1S/C20H26Cl2N2O4S/c1-3-24(11-10-15-4-9-19(21)20(22)12-15)13-17(25)14-28-18-7-5-16(6-8-18)23-29(2,26)27/h4-9,12,17,23,25H,3,10-11,13-14H2,1-2H3/t17-/m0/s1 |
InChIKey | KHLCOSGYTJPDNE-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCN(CCc1ccc(Cl)c(Cl)c1)C[CH](O)COc2ccc(N[S](C)(=O)=O)cc2 | CACTVS 3.385 | CCN(CCc1ccc(Cl)c(Cl)c1)C[C@H](O)COc2ccc(N[S](C)(=O)=O)cc2 | OpenEye OEToolkits 2.0.6 | CCN(CCc1ccc(c(c1)Cl)Cl)CC(COc2ccc(cc2)NS(=O)(=O)C)O | OpenEye OEToolkits 2.0.6 | CCN(CCc1ccc(c(c1)Cl)Cl)C[C@@H](COc2ccc(cc2)NS(=O)(=O)C)O | ACDLabs 12.01 | c1c(cc(c(c1)Cl)Cl)CCN(CC)CC(O)COc2ccc(cc2)NS(=O)(=O)C |
|
Formula | C20 H26 Cl2 N2 O4 S |
Name | N-{4-[(2S)-3-{[2-(3,4-dichlorophenyl)ethyl](ethyl)amino}-2-hydroxypropoxy]phenyl}methanesulfonamide |
ChEMBL | CHEMBL492620 |
DrugBank | |
ZINC | ZINC000034245098
|
PDB chain | 6e7s Chain B Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|