Structure of PDB 6ccn Chain B Binding Site BS01 |
|
|
Ligand ID | EXS |
InChI | InChI=1S/C15H21N3O4/c1-15(2,8-19)13(21)14(22)16-7-6-11-17-9-4-3-5-10(20)12(9)18-11/h3-5,13,19-21H,6-8H2,1-2H3,(H,16,22)(H,17,18)/t13-/m0/s1 |
InChIKey | SKIDJNQZVCDYIE-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)(CO)[CH](O)C(=O)NCCc1[nH]c2c(O)cccc2n1 | OpenEye OEToolkits 2.0.6 | CC(C)(CO)C(C(=O)NCCc1[nH]c2c(n1)cccc2O)O | OpenEye OEToolkits 2.0.6 | CC(C)(CO)[C@H](C(=O)NCCc1[nH]c2c(n1)cccc2O)O | CACTVS 3.385 | CC(C)(CO)[C@@H](O)C(=O)NCCc1[nH]c2c(O)cccc2n1 | ACDLabs 12.01 | c2(nc1c(cccc1O)n2)CCNC(=O)C(C(C)(C)CO)O |
|
Formula | C15 H21 N3 O4 |
Name | (2R)-2,4-dihydroxy-N-[2-(7-hydroxy-1H-benzimidazol-2-yl)ethyl]-3,3-dimethylbutanamide |
ChEMBL | CHEMBL4077924 |
DrugBank | |
ZINC |
|
PDB chain | 6ccn Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
H18 K42 R91 S129 |
Catalytic site (residue number reindexed from 1) |
H17 K41 R90 S128 |
Enzyme Commision number |
2.7.7.3: pantetheine-phosphate adenylyltransferase. |
|
|
|