Structure of PDB 6c6p Chain B Binding Site BS01 |
|
|
Ligand ID | EMV |
InChI | InChI=1S/C27H31NOS2/c1-5-28(14-8-6-7-13-27(2,3)4)18-22-10-9-11-25(16-22)29-19-26-17-24(21-31-26)23-12-15-30-20-23/h6,8-12,15-17,20-21H,5,14,18-19H2,1-4H3/b8-6+ |
InChIKey | KIRGLCXNEVICOG-SOFGYWHQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCN(C/C=C/C#CC(C)(C)C)Cc1cccc(c1)OCc2cc(cs2)c3ccsc3 | CACTVS 3.385 | CCN(CC=CC#CC(C)(C)C)Cc1cccc(OCc2scc(c2)c3cscc3)c1 | OpenEye OEToolkits 2.0.6 | CCN(CC=CC#CC(C)(C)C)Cc1cccc(c1)OCc2cc(cs2)c3ccsc3 | CACTVS 3.385 | CCN(C\C=C\C#CC(C)(C)C)Cc1cccc(OCc2scc(c2)c3cscc3)c1 | ACDLabs 12.01 | c2c(c1cscc1)csc2COc3cccc(c3)CN(C\C=C\C#CC(C)(C)C)CC |
|
Formula | C27 H31 N O S2 |
Name | (2E)-N-({3-[([3,3'-bithiophen]-5-yl)methoxy]phenyl}methyl)-N-ethyl-6,6-dimethylhept-2-en-4-yn-1-amine |
ChEMBL | CHEMBL27885 |
DrugBank | |
ZINC | ZINC000002003883
|
PDB chain | 6c6p Chain B Residue 605
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.14.14.17: squalene monooxygenase. |
|
|
|