Structure of PDB 6atr Chain B Binding Site BS01 |
|
|
Ligand ID | BWS |
InChI | InChI=1S/C10H17N3O6/c1-5(9(17)12-4-8(15)16)13-7(14)3-2-6(11)10(18)19/h5-6H,2-4,11H2,1H3,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
InChIKey | RPVCUZZJCXVVDW-WDSKDSINSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | NC(CCC(=O)NC(C(NCC(=O)O)=O)C)C(=O)O | CACTVS 3.385 | C[CH](NC(=O)CC[CH](N)C(O)=O)C(=O)NCC(O)=O | CACTVS 3.385 | C[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O | OpenEye OEToolkits 2.0.6 | C[C@@H](C(=O)NCC(=O)O)NC(=O)CC[C@@H](C(=O)O)N | OpenEye OEToolkits 2.0.6 | CC(C(=O)NCC(=O)O)NC(=O)CCC(C(=O)O)N |
|
Formula | C10 H17 N3 O6 |
Name | L-gamma-glutamyl-L-alanylglycine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6atr Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|