Structure of PDB 6arn Chain B Binding Site BS01 |
|
|
Ligand ID | BQY |
InChI | InChI=1S/C13H18O7/c1-18-7-4-2-3-5-8(7)19-13-12(17)11(16)10(15)9(6-14)20-13/h2-5,9-17H,6H2,1H3/t9-,10+,11+,12-,13-/m1/s1 |
InChIKey | WBZPEZUBVIAKKS-KSSYENDESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | COc1ccccc1OC2C(C(C(C(O2)CO)O)O)O | CACTVS 3.385 | COc1ccccc1O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O | OpenEye OEToolkits 2.0.6 | COc1ccccc1O[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O | CACTVS 3.385 | COc1ccccc1O[CH]2O[CH](CO)[CH](O)[CH](O)[CH]2O | ACDLabs 12.01 | c2cc(c(OC1C(O)C(O)C(C(CO)O1)O)cc2)OC |
|
Formula | C13 H18 O7 |
Name | 2-methoxyphenyl beta-D-galactopyranoside; o-methoxyphenyl beta-galactoside; OMPG; 2-methoxyphenyl beta-D-galactoside; 2-methoxyphenyl D-galactoside; 2-methoxyphenyl galactoside |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6arn Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|