Structure of PDB 5y2t Chain B Binding Site BS01 |
|
|
Ligand ID | 8LX |
InChI | InChI=1S/C24H24N4O5S/c1-28(21-14-22(26-15-25-21)33-19-9-7-17(31-2)8-10-19)11-12-32-18-5-3-16(4-6-18)13-20-23(29)27-24(30)34-20/h3-10,14-15,20H,11-13H2,1-2H3,(H,27,29,30)/t20-/m0/s1 |
InChIKey | CHHXEZSCHQVSRE-FQEVSTJZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CN(CCOc1ccc(cc1)C[C@H]2C(=O)NC(=O)S2)c3cc(ncn3)Oc4ccc(cc4)OC | OpenEye OEToolkits 2.0.6 | CN(CCOc1ccc(cc1)CC2C(=O)NC(=O)S2)c3cc(ncn3)Oc4ccc(cc4)OC | CACTVS 3.385 | COc1ccc(Oc2cc(ncn2)N(C)CCOc3ccc(C[CH]4SC(=O)NC4=O)cc3)cc1 | CACTVS 3.385 | COc1ccc(Oc2cc(ncn2)N(C)CCOc3ccc(C[C@@H]4SC(=O)NC4=O)cc3)cc1 |
|
Formula | C24 H24 N4 O5 S |
Name | (5S)-5-[[4-[2-[[6-(4-methoxyphenoxy)pyrimidin-4-yl]-methyl-amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione; Lobeglitazone |
ChEMBL | |
DrugBank | |
ZINC | ZINC000033972993
|
PDB chain | 5y2t Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|