Structure of PDB 5xic Chain B Binding Site BS01 |
|
|
Ligand ID | WXP |
InChI | InChI=1S/C38H24N4.Fe/c1-4-10-25(11-5-1)36-30-18-16-28(39-30)24-29-17-19-31(40-29)37(26-12-6-2-7-13-26)33-21-23-35(42-33)38(27-14-8-3-9-15-27)34-22-20-32(36)41-34;/h1-24H;/q-2;+2/b28-24-,29-24-,36-30-,36-32-,37-31-,37-33-,38-34-,38-35-; |
InChIKey | RLGQLJRFCYPMST-ZBSPJBKZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1ccc(cc1)C2=C3C=CC4=[N]3[Fe]56n7c2ccc7C=C8[N]5=C(C=C8)C(=C9N6C(=C4c1ccccc1)C=C9)c1ccccc1 | CACTVS 3.385 | [Fe]1n2c3ccc2C(=C4C=CC(=N4)C(=C5C=CC(=C(c6ccccc6)C7=NC(=C3)C=C7)[N]15)c8ccccc8)c9ccccc9 | CACTVS 3.385 | [Fe]1n2c3ccc2C(=C4C=CC(=N4)C(=C5C=CC(=C(c6ccccc6)C7=NC(=C3)C=C7)[N@]15)c8ccccc8)c9ccccc9 |
|
Formula | C38 H24 Fe N4 |
Name | 5,10,15-Triphenylporphyrin cpntaining FE |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5xic Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|