Structure of PDB 5wik Chain B Binding Site BS01 |
|
|
Ligand ID | 584 |
InChI | InChI=1S/C19H23F2N5O2/c1-10(2)5-6-26-11(3)18(28)25(4)15-9-22-19(24-17(15)26)23-12-7-13(20)16(27)14(21)8-12/h7-11,27H,5-6H2,1-4H3,(H,22,23,24)/t11-/m1/s1 |
InChIKey | DTEKTGDVSARYDS-LLVKDONJSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)CCN1[CH](C)C(=O)N(C)c2cnc(Nc3cc(F)c(O)c(F)c3)nc12 | OpenEye OEToolkits 1.9.2 | C[C@@H]1C(=O)N(c2cnc(nc2N1CCC(C)C)Nc3cc(c(c(c3)F)O)F)C | CACTVS 3.385 | CC(C)CCN1[C@H](C)C(=O)N(C)c2cnc(Nc3cc(F)c(O)c(F)c3)nc12 | ACDLabs 12.01 | c2(Nc1cc(F)c(O)c(c1)F)ncc3c(n2)N(CCC(C)C)C(C(=O)N3C)C | OpenEye OEToolkits 1.9.2 | CC1C(=O)N(c2cnc(nc2N1CCC(C)C)Nc3cc(c(c(c3)F)O)F)C |
|
Formula | C19 H23 F2 N5 O2 |
Name | (7R)-2-[(3,5-difluoro-4-hydroxyphenyl)amino]-5,7-dimethyl-8-(3-methylbutyl)-7,8-dihydropteridin-6(5H)-one |
ChEMBL | CHEMBL3604889 |
DrugBank | |
ZINC | ZINC000033359423
|
PDB chain | 5wik Chain B Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|