Structure of PDB 5wbr Chain B Binding Site BS01 |
|
|
Ligand ID | A3Y |
InChI | InChI=1S/C19H26F3N5O2/c20-19(21,22)16-10-17(26-6-4-25(5-7-26)8-9-28)24-18(15(16)11-23)27-3-1-2-14(12-27)13-29/h10,14,28-29H,1-9,12-13H2/t14-/m0/s1 |
InChIKey | XNJVLRJGPUMHDH-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1c(c(c(nc1N2CCN(CC2)CCO)N3CCC[C@@H](C3)CO)C#N)C(F)(F)F | CACTVS 3.385 | OCCN1CCN(CC1)c2cc(c(C#N)c(n2)N3CCC[C@H](CO)C3)C(F)(F)F | ACDLabs 12.01 | N3(CCN(c2cc(C(F)(F)F)c(c(N1CC(CCC1)CO)n2)C#N)CC3)CCO | OpenEye OEToolkits 2.0.6 | c1c(c(c(nc1N2CCN(CC2)CCO)N3CCCC(C3)CO)C#N)C(F)(F)F | CACTVS 3.385 | OCCN1CCN(CC1)c2cc(c(C#N)c(n2)N3CCC[CH](CO)C3)C(F)(F)F |
|
Formula | C19 H26 F3 N5 O2 |
Name | 6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-[(3S)-3-(hydroxymethyl)piperidin-1-yl]-4-(trifluoromethyl)pyridine-3-carbonitrile |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5wbr Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|