Structure of PDB 5vje Chain B Binding Site BS01 |
|
|
|
| Ligand ID | GOS |
| InChI | InChI=1S/C6H16O12P2/c7-3(1-17-19(11,12)13)5(9)6(10)4(8)2-18-20(14,15)16/h3-10H,1-2H2,(H2,11,12,13)(H2,14,15,16)/t3-,4+,5-,6-/m1/s1 |
| InChIKey | WOYYTQHMNDWRCW-JGWLITMVSA-N |
| SMILES | | Software | SMILES |
|---|
| OpenEye OEToolkits 2.0.6 | C(C(C(C(C(COP(=O)(O)O)O)O)O)O)OP(=O)(O)O | | OpenEye OEToolkits 2.0.6 | C([C@H]([C@H]([C@@H]([C@H](COP(=O)(O)O)O)O)O)O)OP(=O)(O)O | | CACTVS 3.385 | O[C@@H](CO[P](O)(O)=O)[C@@H](O)[C@H](O)[C@H](O)CO[P](O)(O)=O | | ACDLabs 12.01 | C(C(O)C(O)C(C(COP(=O)(O)O)O)O)OP(O)(=O)O | | CACTVS 3.385 | O[CH](CO[P](O)(O)=O)[CH](O)[CH](O)[CH](O)CO[P](O)(O)=O |
|
| Formula | C6 H16 O12 P2 |
| Name | D-Glucitol-1,6-bisphosphate;
1,6-di-O-phosphono-D-glucitol |
| ChEMBL | CHEMBL404748 |
| DrugBank | |
| ZINC | ZINC000013682453
|
| PDB chain | 5vje Chain B Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|
|
|
|
|
