Structure of PDB 5ux4 Chain B Binding Site BS01 |
|
|
Ligand ID | 3UT |
InChI | InChI=1S/C24H18F2N4O3/c25-21-15(4-1-7-28-21)13-5-6-19-16(9-13)24(12-32-23(27)30-24)17-10-18(14-3-2-8-31-11-14)29-22(26)20(17)33-19/h1,3-7,9-10H,2,8,11-12H2,(H2,27,30)/t24-/m0/s1 |
InChIKey | JAZOCUNZCUBRJX-DEOSSOPVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1cc(c(nc1)F)c2ccc3c(c2)[C@@]4(COC(=N4)N)c5cc(nc(c5O3)F)C6=CCCOC6 | CACTVS 3.385 | NC1=N[C]2(CO1)c3cc(ccc3Oc4c(F)nc(cc24)C5=CCCOC5)c6cccnc6F | CACTVS 3.385 | NC1=N[C@@]2(CO1)c3cc(ccc3Oc4c(F)nc(cc24)C5=CCCOC5)c6cccnc6F | OpenEye OEToolkits 1.9.2 | c1cc(c(nc1)F)c2ccc3c(c2)C4(COC(=N4)N)c5cc(nc(c5O3)F)C6=CCCOC6 | ACDLabs 12.01 | Fc1ncccc1c6cc5c(Oc3c(F)nc(C2=CCCOC2)cc3C54N=C(OC4)N)cc6 |
|
Formula | C24 H18 F2 N4 O3 |
Name | (5S)-3-(5,6-dihydro-2H-pyran-3-yl)-1-fluoro-7-(2-fluoropyridin-3-yl)spiro[chromeno[2,3-c]pyridine-5,4'-[1,3]oxazol]-2'-amine |
ChEMBL | CHEMBL4564735 |
DrugBank | |
ZINC | ZINC000072317156
|
PDB chain | 5ux4 Chain B Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.23.5: cathepsin D. |
|
|
|