Structure of PDB 5u13 Chain B Binding Site BS01 |
|
|
Ligand ID | YH5 |
InChI | InChI=1S/C14H13N5O3S/c1-22-8-4-2-7(3-5-8)9(20)6-23-14-16-10-11(18-14)17-13(15)19-12(10)21/h2-5H,6H2,1H3,(H4,15,16,17,18,19,21) |
InChIKey | SQNJCPSJSYBCFC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ccc(cc1)C(=O)CSc2[nH]c3N=C(N)NC(=O)c3n2 | ACDLabs 12.01 | C3(c2nc(SCC(=O)c1ccc(cc1)OC)nc2N=C(N3)N)=O | OpenEye OEToolkits 2.0.6 | COc1ccc(cc1)C(=O)CSc2[nH]c3c(n2)C(=O)NC(=N3)N |
|
Formula | C14 H13 N5 O3 S |
Name | 2-amino-8-{[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl}-1,9-dihydro-6H-purin-6-one |
ChEMBL | CHEMBL3233207 |
DrugBank | |
ZINC | ZINC000005639805
|
PDB chain | 5u13 Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.5.1.15: dihydropteroate synthase. |
|
|
|