Structure of PDB 5tc5 Chain B Binding Site BS01 |
|
|
Ligand ID | BIG |
InChI | InChI=1S/C16H25N5OS/c1-2-3-4-23-9-12-7-21(8-13(12)22)6-11-5-18-15-14(11)19-10-20-16(15)17/h5,10,12-13,18,22H,2-4,6-9H2,1H3,(H2,17,19,20)/t12-,13+/m1/s1 |
InChIKey | LTSUEVPGSXUJHT-OLZOCXBDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CCCCSCC1CN(CC1O)Cc2c[nH]c3c2ncnc3N | OpenEye OEToolkits 1.5.0 | CCCCSC[C@H]1C[N@](C[C@@H]1O)Cc2c[nH]c3c2ncnc3N | CACTVS 3.341 | CCCCSC[CH]1CN(C[CH]1O)Cc2c[nH]c3c(N)ncnc23 | CACTVS 3.341 | CCCCSC[C@H]1CN(C[C@@H]1O)Cc2c[nH]c3c(N)ncnc23 | ACDLabs 10.04 | S(CCCC)CC3CN(Cc2cnc1c2ncnc1N)CC3O |
|
Formula | C16 H25 N5 O S |
Name | (3R,4S)-1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-4-[(butylsulfanyl)methyl]pyrrolidin-3-ol; butylthio-DADMe-Immucillin A |
ChEMBL | CHEMBL1231347 |
DrugBank | DB07463 |
ZINC | ZINC000013648011
|
PDB chain | 5tc5 Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|