Structure of PDB 5t8p Chain B Binding Site BS01 |
|
|
Ligand ID | 774 |
InChI | InChI=1S/C12H10N2O2S/c13-12(15)8-1-2-9-10(14-8)11-7(3-5-16-9)4-6-17-11/h1-2,4,6H,3,5H2,(H2,13,15) |
InChIKey | JQCNDFJWLIDNDO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.5 | c1cc(nc-2c1OCCc3c2scc3)C(=O)N | CACTVS 3.385 | NC(=O)c1ccc2OCCc3ccsc3c2n1 |
|
Formula | C12 H10 N2 O2 S |
Name | 6,7-dihydrothieno[4,5]oxepino[1,2-~{c}]pyridine-2-carboxamide |
ChEMBL | CHEMBL4086137 |
DrugBank | |
ZINC | ZINC000584905075
|
PDB chain | 5t8p Chain B Residue 703
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|