Structure of PDB 5s71 Chain B Binding Site BS01 |
|
|
Ligand ID | WUV |
InChI | InChI=1S/C10H14N2O4S/c1-5-3-12(10(15)11-9(5)14)8-2-6(13)7(4-17)16-8/h3,6-8,13,17H,2,4H2,1H3,(H,11,14,15)/t6-,7+,8+/m0/s1 |
InChIKey | CPEAGKYEYPXTSP-XLPZGREQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CS)O | CACTVS 3.385 | CC1=CN([C@H]2C[C@H](O)[C@@H](CS)O2)C(=O)NC1=O | OpenEye OEToolkits 2.0.7 | CC1=CN(C(=O)NC1=O)C2CC(C(O2)CS)O | ACDLabs 12.01 | C(S)C2C(CC(N1C(NC(C(C)=C1)=O)=O)O2)O | CACTVS 3.385 | CC1=CN([CH]2C[CH](O)[CH](CS)O2)C(=O)NC1=O |
|
Formula | C10 H14 N2 O4 S |
Name | 5'-thiothymidine |
ChEMBL | CHEMBL463853 |
DrugBank | |
ZINC | ZINC000017327965
|
PDB chain | 5s71 Chain B Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|