Structure of PDB 5p8w Chain B Binding Site BS01 |
|
|
Ligand ID | O01 |
InChI | InChI=1S/C9H12N4S/c1-5-9(14-6(2)11-5)8-3-7(4-10)12-13-8/h3H,4,10H2,1-2H3,(H,12,13) |
InChIKey | IPDYKGULJOZYNW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1c(sc(n1)C)c2cc([nH]n2)CN | ACDLabs 12.01 | n2c(sc(c1cc(CN)nn1)c2C)C | CACTVS 3.385 | Cc1sc(c(C)n1)c2cc(CN)[nH]n2 |
|
Formula | C9 H12 N4 S |
Name | [5-(2,4-dimethyl-1,3-thiazol-5-yl)-1H-pyrazol-3-yl]methanamine; 1-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-1H-pyrazol-5-yl]methanamine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905638
|
PDB chain | 5p8w Chain B Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|