Structure of PDB 5ota Chain B Binding Site BS01 |
|
|
Ligand ID | AQQ |
InChI | InChI=1S/C8H16N2O4/c1-5(7(11)12)10-6(8(13)14)3-2-4-9/h5-6,10H,2-4,9H2,1H3,(H,11,12)(H,13,14)/t5-,6+/m1/s1 |
InChIKey | ZQKXJZFWRBQTIO-RITPCOANSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | C[C@H](C(=O)O)N[C@@H](CCCN)C(=O)O | OpenEye OEToolkits 2.0.6 | CC(C(=O)O)NC(CCCN)C(=O)O | CACTVS 3.385 | C[CH](N[CH](CCCN)C(O)=O)C(O)=O | CACTVS 3.385 | C[C@@H](N[C@@H](CCCN)C(O)=O)C(O)=O |
|
Formula | C8 H16 N2 O4 |
Name | (2~{S})-5-azanyl-2-[[(2~{R})-1-oxidanyl-1-oxidanylidene-propan-2-yl]amino]pentanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000002522560
|
PDB chain | 5ota Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|