Structure of PDB 5o8f Chain B Binding Site BS01 |
|
|
Ligand ID | P9N |
InChI | InChI=1S/C21H34O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14-19,23H,4-12H2,1-3H3/t14-,15-,16+,17-,18+,19+,20+,21-/m1/s1 |
InChIKey | AURFZBICLPNKBZ-YZRLXODZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)C | CACTVS 3.385 | CC(=O)[CH]1CC[CH]2[CH]3CC[CH]4C[CH](O)CC[C]4(C)[CH]3CC[C]12C | OpenEye OEToolkits 2.0.6 | CC(=O)C1CCC2C1(CCC3C2CCC4C3(CCC(C4)O)C)C | CACTVS 3.385 | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
|
Formula | C21 H34 O2 |
Name | Pregnanolone; (3alpha,5beta)-3-Hydroxypregnan-20-one |
ChEMBL | CHEMBL210952 |
DrugBank | DB12308 |
ZINC | ZINC000003800039
|
PDB chain | 5o8f Chain B Residue 509
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|