Structure of PDB 5mwg Chain B Binding Site BS01 |
|
|
Ligand ID | WGX |
InChI | InChI=1S/C25H30N4O4S/c1-27-22-15-20(26-34(32,33)19-11-10-17-8-4-5-9-18(17)14-19)21(29-12-6-3-7-13-29)16-23(22)28(2)25(31)24(27)30/h10-11,14-16,26H,3-9,12-13H2,1-2H3 |
InChIKey | CUHWZFQJNZKBNU-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1C(=O)C(=O)N(C)c2cc(N3CCCCC3)c(N[S](=O)(=O)c4ccc5CCCCc5c4)cc12 | OpenEye OEToolkits 2.0.6 | CN1c2cc(c(cc2N(C(=O)C1=O)C)N3CCCCC3)NS(=O)(=O)c4ccc5c(c4)CCCC5 |
|
Formula | C25 H30 N4 O4 S |
Name | ~{N}-[1,4-dimethyl-2,3-bis(oxidanylidene)-7-piperidin-1-yl-quinoxalin-6-yl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
ChEMBL | CHEMBL4282532 |
DrugBank | |
ZINC | ZINC000015734341
|
PDB chain | 5mwg Chain B Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|