Structure of PDB 5ml2 Chain B Binding Site BS01 |
|
|
Ligand ID | NH6 |
InChI | InChI=1S/C25H27ClN2O4S2/c26-22-12-10-21(11-13-22)19-28(23-8-4-5-9-23)34(31,32)25-16-14-24(15-17-25)33(29,30)27-18-20-6-2-1-3-7-20/h1-3,6-7,10-17,23,27H,4-5,8-9,18-19H2 |
InChIKey | CWMNFAGFCBOHSI-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Clc1ccc(CN(C2CCCC2)[S](=O)(=O)c3ccc(cc3)[S](=O)(=O)NCc4ccccc4)cc1 | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)CNS(=O)(=O)c2ccc(cc2)S(=O)(=O)N(Cc3ccc(cc3)Cl)C4CCCC4 |
|
Formula | C25 H27 Cl N2 O4 S2 |
Name | ~{N}1-[(4-chlorophenyl)methyl]-~{N}1-cyclopentyl-~{N}4-(phenylmethyl)benzene-1,4-disulfonamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000000934012
|
PDB chain | 5ml2 Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|