Structure of PDB 5mfv Chain B Binding Site BS01 |
|
|
Ligand ID | 5PX |
InChI | InChI=1S/C10H12N2O3S/c13-8-3-4-9-10(5-8)16(14,15)11-6-12(9)7-1-2-7/h3-5,7,11,13H,1-2,6H2 |
InChIKey | OMEAYSCNDLQLNC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Oc1ccc2N(CN[S](=O)(=O)c2c1)C3CC3 | OpenEye OEToolkits 1.7.6 | c1cc2c(cc1O)S(=O)(=O)NCN2C3CC3 |
|
Formula | C10 H12 N2 O3 S |
Name | 4-Cyclopropyl-3,4-dihydro-7-hydroxy-2H-1,2,4-benzothiadiazine 1,1-dioxide; BPAM-521 |
ChEMBL | |
DrugBank | |
ZINC | ZINC000118234308
|
PDB chain | 5mfv Chain A Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|